CAS 14235-17-7 is the registry number for Dl-phe-pna, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-amino-N-(4-nitrophenyl)-3-phenylpropanamide (CAS 14235-17-7) is a chemical compound with the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. IUPAC name: 2-amino-N-(4-nitrophenyl)-3-phenylpropanamide. InChIKey: GJHIOWXZFDVUKQ-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O3 |
|---|---|
| Molecular weight | 285.30 g/mol |
| IUPAC name | 2-amino-N-(4-nitrophenyl)-3-phenylpropanamide |
| InChIKey | GJHIOWXZFDVUKQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)