CAS 93-47-0 appears in our catalog under these names: Verazide, Verazide, 98%, 98%. Offered by: Chemat Brand, TRC, Biosynth, Chemat. Available pack sizes: on request, 500mg, 100mg, 1g, 5g.
N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]pyridine-4-carboxamide (CAS 93-47-0) is a chemical compound with the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. IUPAC name: N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]pyridine-4-carboxamide. InChIKey: HPXIKMBHOXLFOR-LICLKQGHSA-N.
| Molecular formula | C15H15N3O3 |
|---|---|
| Molecular weight | 285.30 g/mol |
| IUPAC name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]pyridine-4-carboxamide |
| InChIKey | HPXIKMBHOXLFOR-LICLKQGHSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=N/NC(=O)C2=CC=NC=C2)OC |
Computed by PubChem (NCBI)