CAS 14235-18-8 appears in our catalog under these names: D-Phenylalanine 4-Nitroanilide, H–D–Phe–pNA. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10g, 25g, 5g, Get quote.
(2R)-2-amino-N-(4-nitrophenyl)-3-phenylpropanamide (CAS 14235-18-8) is a chemical compound with the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. IUPAC name: (2R)-2-amino-N-(4-nitrophenyl)-3-phenylpropanamide. InChIKey: GJHIOWXZFDVUKQ-CQSZACIVSA-N.
| Molecular formula | C15H15N3O3 |
|---|---|
| Molecular weight | 285.30 g/mol |
| IUPAC name | (2R)-2-amino-N-(4-nitrophenyl)-3-phenylpropanamide |
| InChIKey | GJHIOWXZFDVUKQ-CQSZACIVSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)