CAS 142383-75-3 is the registry number for 5-Chloro-2-thiazol-4-yl-1H-benzoimidazole, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.
4-(6-chloro-1H-benzimidazol-2-yl)-1,3-thiazole (CAS 142383-75-3) is a chemical compound with the molecular formula C10H6ClN3S and a molecular weight of 235.69 g/mol. IUPAC name: 4-(6-chloro-1H-benzimidazol-2-yl)-1,3-thiazole. InChIKey: YTPUQGNBJYGJTB-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN3S |
|---|---|
| Molecular weight | 235.69 g/mol |
| IUPAC name | 4-(6-chloro-1H-benzimidazol-2-yl)-1,3-thiazole |
| InChIKey | YTPUQGNBJYGJTB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=N2)C3=CSC=N3 |
Computed by PubChem (NCBI)