CAS 5936-66-3 is the registry number for 3-chloro-5H-pyridazino[3,4-b][1,4]benzothiazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-chloro-5H-pyridazino[3,4-b][1,4]benzothiazine (CAS 5936-66-3) is a chemical compound with the molecular formula C10H6ClN3S and a molecular weight of 235.69 g/mol. IUPAC name: 3-chloro-5H-pyridazino[3,4-b][1,4]benzothiazine. InChIKey: YLMPLEXXFPCGNB-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN3S |
|---|---|
| Molecular weight | 235.69 g/mol |
| IUPAC name | 3-chloro-5H-pyridazino[3,4-b][1,4]benzothiazine |
| InChIKey | YLMPLEXXFPCGNB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=CC(=NN=C3S2)Cl |
Computed by PubChem (NCBI)