CAS 1548812-76-5 is the registry number for 1-(4-Chloro-1,3-thiazol-2-yl)-1H-1,3-benzodiazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(benzimidazol-1-yl)-4-chloro-1,3-thiazole (CAS 1548812-76-5) is a chemical compound with the molecular formula C10H6ClN3S and a molecular weight of 235.69 g/mol. IUPAC name: 2-(benzimidazol-1-yl)-4-chloro-1,3-thiazole. InChIKey: RTKMLTSSLDGMKN-UHFFFAOYSA-N.
| Molecular formula | C10H6ClN3S |
|---|---|
| Molecular weight | 235.69 g/mol |
| IUPAC name | 2-(benzimidazol-1-yl)-4-chloro-1,3-thiazole |
| InChIKey | RTKMLTSSLDGMKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CN2C3=NC(=CS3)Cl |
Computed by PubChem (NCBI)