Products 1424304-11-9
CAS 1424304-11-9 is the registry number for 2-Bromo-4-(trifluoromethyl)phenylurea, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-bromo-4-(trifluoromethyl)phenyl]urea (CAS 1424304-11-9) is a chemical compound with the molecular formula C8H6BrF3N2O and a molecular weight of 283.04 g/mol. IUPAC name: [2-bromo-4-(trifluoromethyl)phenyl]urea. InChIKey: UKOXOYHFFZIJDQ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3N2O |
|---|---|
| Molecular weight | 283.04 g/mol |
| IUPAC name | [2-bromo-4-(trifluoromethyl)phenyl]urea |
| InChIKey | UKOXOYHFFZIJDQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)NC(=O)N |
Computed by PubChem (NCBI)