Products 2844396-29-6
CAS 2844396-29-6 is the registry number for 6-Bromo-8-(trifluoromethyl)-3,4-dihydropyrrolo[1,2-a]pyrazin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-8-(trifluoromethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one (CAS 2844396-29-6) is a chemical compound with the molecular formula C8H6BrF3N2O and a molecular weight of 283.04 g/mol. IUPAC name: 6-bromo-8-(trifluoromethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one. InChIKey: YSXKADYACFUHAQ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3N2O |
|---|---|
| Molecular weight | 283.04 g/mol |
| IUPAC name | 6-bromo-8-(trifluoromethyl)-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-1-one |
| InChIKey | YSXKADYACFUHAQ-UHFFFAOYSA-N |
| SMILES | C1CN2C(=CC(=C2C(=O)N1)C(F)(F)F)Br |
Computed by PubChem (NCBI)