Products 2758379-92-7
CAS 2758379-92-7 is the registry number for 7-Bromo-5-(trifluoromethyl)-2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-5-(trifluoromethyl)-2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine (CAS 2758379-92-7) is a chemical compound with the molecular formula C8H6BrF3N2O and a molecular weight of 283.04 g/mol. IUPAC name: 7-bromo-5-(trifluoromethyl)-2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine. InChIKey: LUXWFTPOYFNKGZ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3N2O |
|---|---|
| Molecular weight | 283.04 g/mol |
| IUPAC name | 7-bromo-5-(trifluoromethyl)-2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine |
| InChIKey | LUXWFTPOYFNKGZ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N=C(C=C2N1)Br)C(F)(F)F |
Computed by PubChem (NCBI)