CAS 1424329-36-1 is the registry number for (1S,4R,5R,6S)-5-Nitro-6-phenylbicyclo(2.2.1)hept-2-ene. Offered by: TRC. Available pack sizes: 500mg, 50mg.
(1R,4S,5S,6R)-5-nitro-6-phenylbicyclo[2.2.1]hept-2-ene (CAS 1424329-36-1) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: (1R,4S,5S,6R)-5-nitro-6-phenylbicyclo[2.2.1]hept-2-ene. InChIKey: ABLIRAIUNBLRPK-RNJOBUHISA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | (1R,4S,5S,6R)-5-nitro-6-phenylbicyclo[2.2.1]hept-2-ene |
| InChIKey | ABLIRAIUNBLRPK-RNJOBUHISA-N |
| SMILES | C1[C@@H]2C=C[C@H]1[C@@H]([C@H]2C3=CC=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)