CAS 1424369-37-8 appears in our catalog under these names: 3-Chlorobenzofuro[2,3-b]pyridine, 98%, 3–Chlorobenzofuro(2,3–b)pyridine. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g.
3-chloro-[1]benzofuro[2,3-b]pyridine (CAS 1424369-37-8) is a chemical compound with the molecular formula C11H6ClNO and a molecular weight of 203.62 g/mol. IUPAC name: 3-chloro-[1]benzofuro[2,3-b]pyridine. InChIKey: LYLVVZXYLSJKJY-UHFFFAOYSA-N.
| Molecular formula | C11H6ClNO |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | 3-chloro-[1]benzofuro[2,3-b]pyridine |
| InChIKey | LYLVVZXYLSJKJY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)N=CC(=C3)Cl |
Computed by PubChem (NCBI)