CAS 627086-17-3 appears in our catalog under these names: 4-Chlorofuro[3,2-c]quinoline 97%, 4-Chlorofuro[3,2-c]quinoline, 98%, 98%, 4-CHLOROFURO[3,2-C]QUINOLINE, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg.
4-chlorofuro[3,2-c]quinoline (CAS 627086-17-3) is a chemical compound with the molecular formula C11H6ClNO and a molecular weight of 203.62 g/mol. IUPAC name: 4-chlorofuro[3,2-c]quinoline. InChIKey: VZKATVWAQFVLLM-UHFFFAOYSA-N.
| Molecular formula | C11H6ClNO |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | 4-chlorofuro[3,2-c]quinoline |
| InChIKey | VZKATVWAQFVLLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CO3)C(=N2)Cl |
Computed by PubChem (NCBI)