CAS 31874-87-0 is the registry number for 2-Chlorobenzofuro[2,3-b]pyridine 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-[1]benzofuro[2,3-b]pyridine (CAS 31874-87-0) is a chemical compound with the molecular formula C11H6ClNO and a molecular weight of 203.62 g/mol. IUPAC name: 2-chloro-[1]benzofuro[2,3-b]pyridine. InChIKey: DVNXIHPAAAXBOV-UHFFFAOYSA-N.
| Molecular formula | C11H6ClNO |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | 2-chloro-[1]benzofuro[2,3-b]pyridine |
| InChIKey | DVNXIHPAAAXBOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)N=C(C=C3)Cl |
Computed by PubChem (NCBI)