Products 14246-87-8
CAS 14246-87-8 is the registry number for 1-(6-Chloropyridazin-3-yl)-3-methyl-4,5-dihydro-1H-pyrazol-5-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(6-chloropyridazin-3-yl)-5-methyl-4H-pyrazol-3-one (CAS 14246-87-8) is a chemical compound with the molecular formula C8H7ClN4O and a molecular weight of 210.62 g/mol. IUPAC name: 2-(6-chloropyridazin-3-yl)-5-methyl-4H-pyrazol-3-one. InChIKey: HDASDUGTBNZTRH-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4O |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 2-(6-chloropyridazin-3-yl)-5-methyl-4H-pyrazol-3-one |
| InChIKey | HDASDUGTBNZTRH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1)C2=NN=C(C=C2)Cl |
Computed by PubChem (NCBI)