CAS 142499-65-8 is the registry number for 6–(3–Chlorophenyl)–2–oxo–1,2–dihydropyridine–3–carbonitrile. Offered by: GLPBio. Available pack sizes: 250mg.
6-(3-chlorophenyl)-2-oxo-1H-pyridine-3-carbonitrile (CAS 142499-65-8) is a chemical compound with the molecular formula C12H7ClN2O and a molecular weight of 230.65 g/mol. IUPAC name: 6-(3-chlorophenyl)-2-oxo-1H-pyridine-3-carbonitrile. InChIKey: CEXONEQUNDRHAJ-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2O |
|---|---|
| Molecular weight | 230.65 g/mol |
| IUPAC name | 6-(3-chlorophenyl)-2-oxo-1H-pyridine-3-carbonitrile |
| InChIKey | CEXONEQUNDRHAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC=C(C(=O)N2)C#N |
Computed by PubChem (NCBI)