CAS 52334-06-2 is the registry number for 2-(4-Chlorophenyl)oxazolo[5,4-b]pyridine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-chlorophenyl)-[1,3]oxazolo[5,4-b]pyridine (CAS 52334-06-2) is a chemical compound with the molecular formula C12H7ClN2O and a molecular weight of 230.65 g/mol. IUPAC name: 2-(4-chlorophenyl)-[1,3]oxazolo[5,4-b]pyridine. InChIKey: YSJNMDBVFPXECZ-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2O |
|---|---|
| Molecular weight | 230.65 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-[1,3]oxazolo[5,4-b]pyridine |
| InChIKey | YSJNMDBVFPXECZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)OC(=N2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)