CAS 943230-33-9 appears in our catalog under these names: 4-Chloro-6-phenylfuro(2,3-d)pyrimidine, 98%, 4-Chloro-6-phenylfuro[2,3-d]pyrimidine, 98%, 98%, 4-Chloro-6-phenylfuro[2,3-d]pyrimidine, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
4-chloro-6-phenylfuro[2,3-d]pyrimidine (CAS 943230-33-9) is a chemical compound with the molecular formula C12H7ClN2O and a molecular weight of 230.65 g/mol. IUPAC name: 4-chloro-6-phenylfuro[2,3-d]pyrimidine. InChIKey: BMPUSSWCLJQHOR-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2O |
|---|---|
| Molecular weight | 230.65 g/mol |
| IUPAC name | 4-chloro-6-phenylfuro[2,3-d]pyrimidine |
| InChIKey | BMPUSSWCLJQHOR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(O2)N=CN=C3Cl |
Computed by PubChem (NCBI)