CAS 14252-18-7 appears in our catalog under these names: 2,6-Dimethyl-4-tert-butylbenzophenone, 95%, 2,6-Dimethyl-4-tert-butylbenzophenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 1000mg, 500mg, 2000mg.
(4-tert-butyl-2,6-dimethylphenyl)-phenylmethanone (CAS 14252-18-7) is a chemical compound with the molecular formula C19H22O and a molecular weight of 266.4 g/mol. IUPAC name: (4-tert-butyl-2,6-dimethylphenyl)-phenylmethanone. InChIKey: JSUGLRMWYOZWBR-UHFFFAOYSA-N.
| Molecular formula | C19H22O |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | (4-tert-butyl-2,6-dimethylphenyl)-phenylmethanone |
| InChIKey | JSUGLRMWYOZWBR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)C2=CC=CC=C2)C)C(C)(C)C |
Computed by PubChem (NCBI)