CAS 147834-57-9 is the registry number for 1-(2,3,4,5,6-Pentamethylphenyl)-2-phenylethan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
1-(2,3,4,5,6-pentamethylphenyl)-2-phenylethanone (CAS 147834-57-9) is a chemical compound with the molecular formula C19H22O and a molecular weight of 266.4 g/mol. IUPAC name: 1-(2,3,4,5,6-pentamethylphenyl)-2-phenylethanone. InChIKey: CFSAHKOFVAHZDH-UHFFFAOYSA-N.
| Molecular formula | C19H22O |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | 1-(2,3,4,5,6-pentamethylphenyl)-2-phenylethanone |
| InChIKey | CFSAHKOFVAHZDH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)C(=O)CC2=CC=CC=C2)C)C |
Computed by PubChem (NCBI)