CAS 50460-53-2 appears in our catalog under these names: 2,2'-Dimethyl-5-tert-butylbenzophenone, 95%, 2,2'-Dimethyl-5-tert-butylbenzophenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg.
(5-tert-butyl-2-methylphenyl)-(2-methylphenyl)methanone (CAS 50460-53-2) is a chemical compound with the molecular formula C19H22O and a molecular weight of 266.4 g/mol. IUPAC name: (5-tert-butyl-2-methylphenyl)-(2-methylphenyl)methanone. InChIKey: NFRDSOMKJZLIOE-UHFFFAOYSA-N.
| Molecular formula | C19H22O |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | (5-tert-butyl-2-methylphenyl)-(2-methylphenyl)methanone |
| InChIKey | NFRDSOMKJZLIOE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)(C)C)C(=O)C2=CC=CC=C2C |
Computed by PubChem (NCBI)