CAS 1425498-70-9 is the registry number for 6-Phenylpyridazine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-phenylpyridazine-4-carboxylic acid (CAS 1425498-70-9) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 6-phenylpyridazine-4-carboxylic acid. InChIKey: SNUNRNLGUCRYRU-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 6-phenylpyridazine-4-carboxylic acid |
| InChIKey | SNUNRNLGUCRYRU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)