CAS 14257-79-5 is the registry number for β-D-Galaltosamine (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,4R,5R,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;hydrochloride (CAS 14257-79-5) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: (2R,3R,4R,5R,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;hydrochloride. InChIKey: QKPLRMLTKYXDST-WYRLRVFGSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | (2R,3R,4R,5R,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;hydrochloride |
| InChIKey | QKPLRMLTKYXDST-WYRLRVFGSA-N |
| SMILES | C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O)N)O)O)O.Cl |
Computed by PubChem (NCBI)