CAS 142576-91-8 is the registry number for 3-(Chlorosulfonyl)-2,6-difluorobenzoic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g.
3-chlorosulfonyl-2,6-difluorobenzoic acid (CAS 142576-91-8) is a chemical compound with the molecular formula C7H3ClF2O4S and a molecular weight of 256.61 g/mol. IUPAC name: 3-chlorosulfonyl-2,6-difluorobenzoic acid. InChIKey: QOVXKOPZKHCCHN-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O4S |
|---|---|
| Molecular weight | 256.61 g/mol |
| IUPAC name | 3-chlorosulfonyl-2,6-difluorobenzoic acid |
| InChIKey | QOVXKOPZKHCCHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)O)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)