Products 142576-91-8

CAS 142576-91-8 is the registry number for 3-(Chlorosulfonyl)-2,6-difluorobenzoic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

3-chlorosulfonyl-2,6-difluorobenzoic acid (CAS 142576-91-8) is a chemical compound with the molecular formula C7H3ClF2O4S and a molecular weight of 256.61 g/mol. IUPAC name: 3-chlorosulfonyl-2,6-difluorobenzoic acid. InChIKey: QOVXKOPZKHCCHN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3ClF2O4S
Molecular weight256.61 g/mol
IUPAC name3-chlorosulfonyl-2,6-difluorobenzoic acid
InChIKeyQOVXKOPZKHCCHN-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1F)C(=O)O)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)