CAS 53916-70-4 appears in our catalog under these names: 5-(Chlorosulfonyl)-2,4-difluorobenzoic acid, 95%, 5-(CHLOROSULFONYL)-2,4-DIFLUOROBENZOIC ACID, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 250mg.
5-chlorosulfonyl-2,4-difluorobenzoic acid (CAS 53916-70-4) is a chemical compound with the molecular formula C7H3ClF2O4S and a molecular weight of 256.61 g/mol. IUPAC name: 5-chlorosulfonyl-2,4-difluorobenzoic acid. InChIKey: FPZITNFVVXGXQS-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O4S |
|---|---|
| Molecular weight | 256.61 g/mol |
| IUPAC name | 5-chlorosulfonyl-2,4-difluorobenzoic acid |
| InChIKey | FPZITNFVVXGXQS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)F)F)C(=O)O |
Computed by PubChem (NCBI)