Products 716361-76-1

CAS 716361-76-1 is the registry number for 3-(Chlorosulfonyl)-4,5-difluorobenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-chlorosulfonyl-4,5-difluorobenzoic acid (CAS 716361-76-1) is a chemical compound with the molecular formula C7H3ClF2O4S and a molecular weight of 256.61 g/mol. IUPAC name: 3-chlorosulfonyl-4,5-difluorobenzoic acid. InChIKey: LYRVUABWLWZHNK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3ClF2O4S
Molecular weight256.61 g/mol
IUPAC name3-chlorosulfonyl-4,5-difluorobenzoic acid
InChIKeyLYRVUABWLWZHNK-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1F)F)S(=O)(=O)Cl)C(=O)O

Computed by PubChem (NCBI)