Products 1425927-75-8
CAS 1425927-75-8 appears in our catalog under these names: 6-Amino-1,3-dimethyl-1,2-dihydroquinolin-2-one, 95%, 6-Amino-1,3-dimethyl-1,2-dihydroquinolin-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
6-amino-1,3-dimethylquinolin-2-one (CAS 1425927-75-8) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: 6-amino-1,3-dimethylquinolin-2-one. InChIKey: FSPMDZJWOCCHDG-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 6-amino-1,3-dimethylquinolin-2-one |
| InChIKey | FSPMDZJWOCCHDG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CC(=C2)N)N(C1=O)C |
Computed by PubChem (NCBI)