Products 1425944-33-7
CAS 1425944-33-7 is the registry number for CYD-4-61. Offered by: MedChemExpress. Available pack sizes: 10 mg, 50 mg, 5 mg, 25 mg.
2-[[3-[(E)-(2-nitrofluoren-9-ylidene)methyl]-2-pyridinyl]oxy]ethanamine (CAS 1425944-33-7) is a chemical compound with the molecular formula C21H17N3O3 and a molecular weight of 359.4 g/mol. IUPAC name: 2-[[3-[(E)-(2-nitrofluoren-9-ylidene)methyl]-2-pyridinyl]oxy]ethanamine. InChIKey: PSTOZJZIPPUYHT-XDHOZWIPSA-N.
| Molecular formula | C21H17N3O3 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 2-[[3-[(E)-(2-nitrofluoren-9-ylidene)methyl]-2-pyridinyl]oxy]ethanamine |
| InChIKey | PSTOZJZIPPUYHT-XDHOZWIPSA-N |
| SMILES | C1=CC=C\2C(=C1)C3=C(/C2=C/C4=C(N=CC=C4)OCCN)C=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)