CAS 1172810-92-2 is the registry number for 2-(4-Methyl-6-oxo-1,3-diphenyl-1,6-dihydro-7H-pyrazolo[3,4-b]pyridin-7-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-methyl-6-oxo-1,3-diphenylpyrazolo[5,4-b]pyridin-7-yl)acetic acid (CAS 1172810-92-2) is a chemical compound with the molecular formula C21H17N3O3 and a molecular weight of 359.4 g/mol. IUPAC name: 2-(4-methyl-6-oxo-1,3-diphenylpyrazolo[5,4-b]pyridin-7-yl)acetic acid. InChIKey: DJGLKBOXUWBCOQ-UHFFFAOYSA-N.
| Molecular formula | C21H17N3O3 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 2-(4-methyl-6-oxo-1,3-diphenylpyrazolo[5,4-b]pyridin-7-yl)acetic acid |
| InChIKey | DJGLKBOXUWBCOQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C2=C1C(=NN2C3=CC=CC=C3)C4=CC=CC=C4)CC(=O)O |
Computed by PubChem (NCBI)