Products 351978-83-1
CAS 351978-83-1 is the registry number for IGP-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[4-(1H-benzo[f]benzimidazol-2-yl)anilino]-4-oxobutanoic acid (CAS 351978-83-1) is a chemical compound with the molecular formula C21H17N3O3 and a molecular weight of 359.4 g/mol. IUPAC name: 4-[4-(1H-benzo[f]benzimidazol-2-yl)anilino]-4-oxobutanoic acid. InChIKey: MNDGQXCAUYSTHC-UHFFFAOYSA-N.
| Molecular formula | C21H17N3O3 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 4-[4-(1H-benzo[f]benzimidazol-2-yl)anilino]-4-oxobutanoic acid |
| InChIKey | MNDGQXCAUYSTHC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)NC(=N3)C4=CC=C(C=C4)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)