Products 2251699-84-8
CAS 2251699-84-8 appears in our catalog under these names: Ozanimod Impurity 4, Des((2-hydroxyethyl)amino) 1-Oxo Ozanimod. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
5-[3-(1-oxo-2,3-dihydroinden-4-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile (CAS 2251699-84-8) is a chemical compound with the molecular formula C21H17N3O3 and a molecular weight of 359.4 g/mol. IUPAC name: 5-[3-(1-oxo-2,3-dihydroinden-4-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile. InChIKey: FZQFRQWSHVIYID-UHFFFAOYSA-N.
| Molecular formula | C21H17N3O3 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 5-[3-(1-oxo-2,3-dihydroinden-4-yl)-1,2,4-oxadiazol-5-yl]-2-propan-2-yloxybenzonitrile |
| InChIKey | FZQFRQWSHVIYID-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)C2=NC(=NO2)C3=C4CCC(=O)C4=CC=C3)C#N |
Computed by PubChem (NCBI)