CAS 142609-62-9 is the registry number for (2S,3R)-4-(3-Methylbutoxy)-4-oxo-2,3-bis-sulfanylbutanoic acid. Offered by: Biosynth. Available pack sizes: 100g.
(2S,3R)-4-(3-methylbutoxy)-4-oxo-2,3-bis(sulfanyl)butanoic acid (CAS 142609-62-9) is a chemical compound with the molecular formula C9H16O4S2 and a molecular weight of 252.4 g/mol. IUPAC name: (2S,3R)-4-(3-methylbutoxy)-4-oxo-2,3-bis(sulfanyl)butanoic acid. InChIKey: RIBYSYWXWXMDSW-RQJHMYQMSA-N.
| Molecular formula | C9H16O4S2 |
|---|---|
| Molecular weight | 252.4 g/mol |
| IUPAC name | (2S,3R)-4-(3-methylbutoxy)-4-oxo-2,3-bis(sulfanyl)butanoic acid |
| InChIKey | RIBYSYWXWXMDSW-RQJHMYQMSA-N |
| SMILES | CC(C)CCOC(=O)[C@H]([C@H](C(=O)O)S)S |
Computed by PubChem (NCBI)