Products 61713-23-3

CAS 61713-23-3 is the registry number for Ethyl 2-({[(2-ethoxy-2-oxoethyl)thio]methyl}thio)acetate, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 10g, 50g.

Structural formula: {0} (CAS {1})

Ethyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethylsulfanyl]acetate (CAS 61713-23-3) is a chemical compound with the molecular formula C9H16O4S2 and a molecular weight of 252.4 g/mol. IUPAC name: ethyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethylsulfanyl]acetate. InChIKey: NBNGVIRHOBZBHM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O4S2
Molecular weight252.4 g/mol
IUPAC nameethyl 2-[(2-ethoxy-2-oxoethyl)sulfanylmethylsulfanyl]acetate
InChIKeyNBNGVIRHOBZBHM-UHFFFAOYSA-N
SMILESCCOC(=O)CSCSCC(=O)OCC

Computed by PubChem (NCBI)