Products 2170117-65-2

CAS 2170117-65-2 is the registry number for 2-Hydroxyethyl 2-((ethoxymethanethioyl)sulfanyl)-2-methylpropanoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-hydroxyethyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate (CAS 2170117-65-2) is a chemical compound with the molecular formula C9H16O4S2 and a molecular weight of 252.4 g/mol. IUPAC name: 2-hydroxyethyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate. InChIKey: OUVBHFVZXYGZAK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O4S2
Molecular weight252.4 g/mol
IUPAC name2-hydroxyethyl 2-ethoxycarbothioylsulfanyl-2-methylpropanoate
InChIKeyOUVBHFVZXYGZAK-UHFFFAOYSA-N
SMILESCCOC(=S)SC(C)(C)C(=O)OCCO

Computed by PubChem (NCBI)