CAS 1426129-52-3 appears in our catalog under these names: Sacubitril Impurity 56, (R)-3-([1,1'-Biphenyl]-4-yl)-2-aminopropan-1-ol, 95%, 95%. Offered by: Hubei YoungXin, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1g.
(2R)-2-amino-3-(4-phenylphenyl)propan-1-ol (CAS 1426129-52-3) is a chemical compound with the molecular formula C15H17NO and a molecular weight of 227.30 g/mol. IUPAC name: (2R)-2-amino-3-(4-phenylphenyl)propan-1-ol. InChIKey: RCAIWVIQRMDTAV-OAHLLOKOSA-N.
| Molecular formula | C15H17NO |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-phenylphenyl)propan-1-ol |
| InChIKey | RCAIWVIQRMDTAV-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C[C@H](CO)N |
Computed by PubChem (NCBI)