CAS 1426174-40-4 is the registry number for (S)-N-Nitroso Anabasine-d4. Offered by: TRC. Available pack sizes: 25mg.
2,3,4,6-tetradeuterio-5-[(2S)-1-nitrosopiperidin-2-yl]pyridine (CAS 1426174-40-4) is a chemical compound with the molecular formula C10H13N3O and a molecular weight of 195.25 g/mol. IUPAC name: 2,3,4,6-tetradeuterio-5-[(2S)-1-nitrosopiperidin-2-yl]pyridine. InChIKey: BXYPVKMROLGXJI-IOADRVQPSA-N.
| Molecular formula | C10H13N3O |
|---|---|
| Molecular weight | 195.25 g/mol |
| IUPAC name | 2,3,4,6-tetradeuterio-5-[(2S)-1-nitrosopiperidin-2-yl]pyridine |
| InChIKey | BXYPVKMROLGXJI-IOADRVQPSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])[C@@H]2CCCCN2N=O)[2H] |
Computed by PubChem (NCBI)