CAS 1795786-06-9 is the registry number for (R)-N-Nitroso Anabasine, ~ 98% ee, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg.
3-[(2R)-1-nitrosopiperidin-2-yl]pyridine (CAS 1795786-06-9) is a chemical compound with the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. IUPAC name: 3-[(2R)-1-nitrosopiperidin-2-yl]pyridine. InChIKey: BXYPVKMROLGXJI-SNVBAGLBSA-N.
| Molecular formula | C10H13N3O |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 3-[(2R)-1-nitrosopiperidin-2-yl]pyridine |
| InChIKey | BXYPVKMROLGXJI-SNVBAGLBSA-N |
| SMILES | C1CCN([C@H](C1)C2=CN=CC=C2)N=O |
Computed by PubChem (NCBI)