CAS 1426243-43-7 appears in our catalog under these names: cis-1-amino-3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid hydrochloride, 98%, rac-(1S,3S)-1-Amino-3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 50mg, 0,5g.
1-amino-3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid;hydrochloride (CAS 1426243-43-7) is a chemical compound with the molecular formula C6H9ClF3NO3 and a molecular weight of 235.59 g/mol. IUPAC name: 1-amino-3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid;hydrochloride. InChIKey: UNBDEHJTWYINQJ-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF3NO3 |
|---|---|
| Molecular weight | 235.59 g/mol |
| IUPAC name | 1-amino-3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid;hydrochloride |
| InChIKey | UNBDEHJTWYINQJ-UHFFFAOYSA-N |
| SMILES | C1C(CC1(C(F)(F)F)O)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)