Products 945382-02-5

CAS 945382-02-5 is the registry number for Ethyl 2-amino-4,4,4-trifluoro-3-oxobutanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-amino-4,4,4-trifluoro-3-oxobutanoate;hydrochloride (CAS 945382-02-5) is a chemical compound with the molecular formula C6H9ClF3NO3 and a molecular weight of 235.59 g/mol. IUPAC name: ethyl 2-amino-4,4,4-trifluoro-3-oxobutanoate;hydrochloride. InChIKey: UKGJDOTVTRIUOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9ClF3NO3
Molecular weight235.59 g/mol
IUPAC nameethyl 2-amino-4,4,4-trifluoro-3-oxobutanoate;hydrochloride
InChIKeyUKGJDOTVTRIUOZ-UHFFFAOYSA-N
SMILESCCOC(=O)C(C(=O)C(F)(F)F)N.Cl

Computed by PubChem (NCBI)