CAS 945382-02-5 is the registry number for Ethyl 2-amino-4,4,4-trifluoro-3-oxobutanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 2-amino-4,4,4-trifluoro-3-oxobutanoate;hydrochloride (CAS 945382-02-5) is a chemical compound with the molecular formula C6H9ClF3NO3 and a molecular weight of 235.59 g/mol. IUPAC name: ethyl 2-amino-4,4,4-trifluoro-3-oxobutanoate;hydrochloride. InChIKey: UKGJDOTVTRIUOZ-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF3NO3 |
|---|---|
| Molecular weight | 235.59 g/mol |
| IUPAC name | ethyl 2-amino-4,4,4-trifluoro-3-oxobutanoate;hydrochloride |
| InChIKey | UKGJDOTVTRIUOZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)