CAS 2377036-33-2 is the registry number for 1-Amino-3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
1-amino-3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid;hydrochloride (CAS 2377036-33-2) is a chemical compound with the molecular formula C6H9ClF3NO3 and a molecular weight of 235.59 g/mol. IUPAC name: 1-amino-3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid;hydrochloride. InChIKey: UNBDEHJTWYINQJ-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF3NO3 |
|---|---|
| Molecular weight | 235.59 g/mol |
| IUPAC name | 1-amino-3-hydroxy-3-(trifluoromethyl)cyclobutane-1-carboxylic acid;hydrochloride |
| InChIKey | UNBDEHJTWYINQJ-UHFFFAOYSA-N |
| SMILES | C1C(CC1(C(F)(F)F)O)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)