Products 1426254-96-7
CAS 1426254-96-7 appears in our catalog under these names: 7-Bromo-5-chloro-1-methyl-1H-pyrazolo[4,3-b]pyridine, 95+%, 95+%, 7-Bromo-5-chloro-1-methyl-1H-pyrazolo[4,3-b]pyridine, 95+%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
7-bromo-5-chloro-1-methylpyrazolo[4,5-b]pyridine (CAS 1426254-96-7) is a chemical compound with the molecular formula C7H5BrClN3 and a molecular weight of 246.49 g/mol. IUPAC name: 7-bromo-5-chloro-1-methylpyrazolo[4,5-b]pyridine. InChIKey: BAJFALUEJVZOCI-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClN3 |
|---|---|
| Molecular weight | 246.49 g/mol |
| IUPAC name | 7-bromo-5-chloro-1-methylpyrazolo[4,5-b]pyridine |
| InChIKey | BAJFALUEJVZOCI-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)N=C(C=C2Br)Cl |
Computed by PubChem (NCBI)