CAS 1426396-32-8 is the registry number for N-Phenyl-4-(1,2,2-triphenylvinyl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-phenyl-4-(1,2,2-triphenylethenyl)aniline (CAS 1426396-32-8) is a chemical compound with the molecular formula C32H25N and a molecular weight of 423.5 g/mol. IUPAC name: N-phenyl-4-(1,2,2-triphenylethenyl)aniline. InChIKey: VUYHAHWLGDLHFA-UHFFFAOYSA-N.
| Molecular formula | C32H25N |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | N-phenyl-4-(1,2,2-triphenylethenyl)aniline |
| InChIKey | VUYHAHWLGDLHFA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=C(C=C3)NC4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)