CAS 1492771-69-3 is the registry number for 4'-(1,2,2-Triphenylvinyl)-[1,1'-biphenyl]-4-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-(1,2,2-triphenylethenyl)phenyl]aniline (CAS 1492771-69-3) is a chemical compound with the molecular formula C32H25N and a molecular weight of 423.5 g/mol. IUPAC name: 4-[4-(1,2,2-triphenylethenyl)phenyl]aniline. InChIKey: QKGNHYLKMFYEGF-UHFFFAOYSA-N.
| Molecular formula | C32H25N |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | 4-[4-(1,2,2-triphenylethenyl)phenyl]aniline |
| InChIKey | QKGNHYLKMFYEGF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)N)C5=CC=CC=C5 |
Computed by PubChem (NCBI)