CAS 89114-90-9 appears in our catalog under these names: 4-N,N-Diphenylamino-ß-phenylstilbene, 4–(2,2–Diphenylvinyl)–N,N–diphenylaniline. Offered by: TRC, GLPBio. Available pack sizes: 1g, 2g, 500mg.
4-(2,2-diphenylethenyl)-N,N-diphenylaniline (CAS 89114-90-9) is a chemical compound with the molecular formula C32H25N and a molecular weight of 423.5 g/mol. IUPAC name: 4-(2,2-diphenylethenyl)-N,N-diphenylaniline. InChIKey: NIZIGUQDQIALBQ-UHFFFAOYSA-N.
| Molecular formula | C32H25N |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | 4-(2,2-diphenylethenyl)-N,N-diphenylaniline |
| InChIKey | NIZIGUQDQIALBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=CC2=CC=C(C=C2)N(C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)