CAS 1427027-84-6 is the registry number for 2-((3,4-Dichlorobenzyl)oxy)-3-methylbenzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3,4-dichlorophenyl)methoxy]-3-methylbenzaldehyde (CAS 1427027-84-6) is a chemical compound with the molecular formula C15H12Cl2O2 and a molecular weight of 295.2 g/mol. IUPAC name: 2-[(3,4-dichlorophenyl)methoxy]-3-methylbenzaldehyde. InChIKey: SVQGENAGXUSNNR-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2O2 |
|---|---|
| Molecular weight | 295.2 g/mol |
| IUPAC name | 2-[(3,4-dichlorophenyl)methoxy]-3-methylbenzaldehyde |
| InChIKey | SVQGENAGXUSNNR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C=O)OCC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)