CAS 1820685-84-4 is the registry number for methyl 2-[3-(3,5-dichlorophenyl)phenyl]acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-[3-(3,5-dichlorophenyl)phenyl]acetate (CAS 1820685-84-4) is a chemical compound with the molecular formula C15H12Cl2O2 and a molecular weight of 295.2 g/mol. IUPAC name: methyl 2-[3-(3,5-dichlorophenyl)phenyl]acetate. InChIKey: WYCMWDKJWLQAFH-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2O2 |
|---|---|
| Molecular weight | 295.2 g/mol |
| IUPAC name | methyl 2-[3-(3,5-dichlorophenyl)phenyl]acetate |
| InChIKey | WYCMWDKJWLQAFH-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=CC=C1)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)