CAS 153529-19-2 appears in our catalog under these names: 2–(2,4–dichlorophenyl)–1–(4–methoxyphenyl)ethanone, 2-(2,4-Dichlorophenyl)-1-(4-methoxyphenyl)ethanone, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
2-(2,4-dichlorophenyl)-1-(4-methoxyphenyl)ethanone (CAS 153529-19-2) is a chemical compound with the molecular formula C15H12Cl2O2 and a molecular weight of 295.2 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-1-(4-methoxyphenyl)ethanone. InChIKey: HSEZPMFPNJGRPQ-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2O2 |
|---|---|
| Molecular weight | 295.2 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-1-(4-methoxyphenyl)ethanone |
| InChIKey | HSEZPMFPNJGRPQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)CC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)