CAS 14271-45-5 appears in our catalog under these names: 1-Methyl-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 95%, 1-Methyl-2-oxo-3,4-dihydroquinoline-4-carboxylic Acid, 1-Methyl-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 1-Methyl-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 95+%, 95+%. Offered by: Combi-blocks, TRC, Biosynth, Chemat. Available pack sizes: 5g, 1g, 10mg, 1mg, 5mg, 0,5g, 100mg.
1-methyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid (CAS 14271-45-5) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 1-methyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid. InChIKey: BCKRBJBCJOYSLP-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 1-methyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid |
| InChIKey | BCKRBJBCJOYSLP-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC(C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)