CAS 1427195-46-7 appears in our catalog under these names: 1,2,3,4-Tetrahydroquinolin-8-amine hydrochloride, 95%, 1,2,3,4-Tetrahydroquinolin-8-amine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
1,2,3,4-tetrahydroquinolin-8-amine;hydrochloride (CAS 1427195-46-7) is a chemical compound with the molecular formula C9H13ClN2 and a molecular weight of 184.66 g/mol. IUPAC name: 1,2,3,4-tetrahydroquinolin-8-amine;hydrochloride. InChIKey: DLTPSLJLSVMXHE-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2 |
|---|---|
| Molecular weight | 184.66 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroquinolin-8-amine;hydrochloride |
| InChIKey | DLTPSLJLSVMXHE-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC=C2)N)NC1.Cl |
Computed by PubChem (NCBI)