CAS 210094-28-3 appears in our catalog under these names: (R)-3-(Pyrrolidin-2-yl)pyridine hydrochloride, 95%, (R)-3-(Pyrrolidin-2-yl)pyridine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 25g, 250mg.
3-[(2R)-pyrrolidin-2-yl]pyridine;hydrochloride (CAS 210094-28-3) is a chemical compound with the molecular formula C9H13ClN2 and a molecular weight of 184.66 g/mol. IUPAC name: 3-[(2R)-pyrrolidin-2-yl]pyridine;hydrochloride. InChIKey: JRTXSGXQWWLEEU-SBSPUUFOSA-N.
| Molecular formula | C9H13ClN2 |
|---|---|
| Molecular weight | 184.66 g/mol |
| IUPAC name | 3-[(2R)-pyrrolidin-2-yl]pyridine;hydrochloride |
| InChIKey | JRTXSGXQWWLEEU-SBSPUUFOSA-N |
| SMILES | C1C[C@@H](NC1)C2=CN=CC=C2.Cl |
Computed by PubChem (NCBI)