CAS 1184296-04-5 appears in our catalog under these names: (2,3-Dihydro-1h-inden-5-yl)hydrazine hydrochloride, 95%, (2,3-Dihydro-1H-inden-5-yl)hydrazine hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 1g, 5g.
2,3-dihydro-1H-inden-5-ylhydrazine;hydrochloride (CAS 1184296-04-5) is a chemical compound with the molecular formula C9H13ClN2 and a molecular weight of 184.66 g/mol. IUPAC name: 2,3-dihydro-1H-inden-5-ylhydrazine;hydrochloride. InChIKey: QDTUDBCUGJLIFO-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2 |
|---|---|
| Molecular weight | 184.66 g/mol |
| IUPAC name | 2,3-dihydro-1H-inden-5-ylhydrazine;hydrochloride |
| InChIKey | QDTUDBCUGJLIFO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)NN.Cl |
Computed by PubChem (NCBI)