Products 1184296-04-5

CAS 1184296-04-5 appears in our catalog under these names: (2,3-Dihydro-1h-inden-5-yl)hydrazine hydrochloride, 95%, (2,3-Dihydro-1H-inden-5-yl)hydrazine hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

2,3-dihydro-1H-inden-5-ylhydrazine;hydrochloride (CAS 1184296-04-5) is a chemical compound with the molecular formula C9H13ClN2 and a molecular weight of 184.66 g/mol. IUPAC name: 2,3-dihydro-1H-inden-5-ylhydrazine;hydrochloride. InChIKey: QDTUDBCUGJLIFO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13ClN2
Molecular weight184.66 g/mol
IUPAC name2,3-dihydro-1H-inden-5-ylhydrazine;hydrochloride
InChIKeyQDTUDBCUGJLIFO-UHFFFAOYSA-N
SMILESC1CC2=C(C1)C=C(C=C2)NN.Cl

Computed by PubChem (NCBI)